About propyl 3-(oxomethylidene)-6-propoxycyclohexa-1,5-diene-1-carboxylate
propyl 3-(oxomethylidene)-6-propoxycyclohexa-1,5-diene-1-carboxylate (PubChem CID 87601617) has the molecular formula C14H18O4
and a molecular weight of 250.29 g/mol. Its IUPAC name is propyl 3-(oxomethylidene)-6-propoxycyclohexa-1,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | propyl 3-(oxomethylidene)-6-propoxycyclohexa-1,5-diene-1-carboxylate |
| PubChem CID | 87601617 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | propyl 3-(oxomethylidene)-6-propoxycyclohexa-1,5-diene-1-carboxylate |
| SMILES | CCCOC(=O)C1=CC(=C=O)CC=C1OCCC |
| InChI | InChI=1S/C14H18O4/c1-3-7-17-13-6-5-11(10-15)9-12(13)14(16)18-8-4-2/h6,9H,3-5,7-8H2,1-2H3 |
| InChIKey | MWKUBIYQUPMKGS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze propyl 3-(oxomethylidene)-6-propoxycyclohexa-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 3-(oxomethylidene)-6-propoxycyclohexa-1,5-diene-1-carboxylate?
The IUPAC name of propyl 3-(oxomethylidene)-6-propoxycyclohexa-1,5-diene-1-carboxylate (CID 87601617) is propyl 3-(oxomethylidene)-6-propoxycyclohexa-1,5-diene-1-carboxylate.
What is the SMILES notation for propyl 3-(oxomethylidene)-6-propoxycyclohexa-1,5-diene-1-carboxylate?
The canonical SMILES for propyl 3-(oxomethylidene)-6-propoxycyclohexa-1,5-diene-1-carboxylate is CCCOC(=O)C1=CC(=C=O)CC=C1OCCC.
What is the InChIKey of propyl 3-(oxomethylidene)-6-propoxycyclohexa-1,5-diene-1-carboxylate?
The InChIKey is MWKUBIYQUPMKGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O4/c1-3-7-17-13-6-5-11(10-15)9-12(13)14(16)18-8-4-2/h6,9H,3-5,7-8H2,1-2H3.
What are the key properties of propyl 3-(oxomethylidene)-6-propoxycyclohexa-1,5-diene-1-carboxylate?
propyl 3-(oxomethylidene)-6-propoxycyclohexa-1,5-diene-1-carboxylate has a molecular weight of 250.29 g/mol, XLogP of 2.34, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 3-(oxomethylidene)-6-propoxycyclohexa-1,5-diene-1-carboxylate is sourced from PubChem (CID 87601617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).