C25H24F3N2O2+ — CID 87601747
2-(2-pyridin-2-ylethyl)-2-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-3H-isoindol-2-ium-1-one (PubChem CID 87601747) has the molecular formula C25H24F3N2O2+ and a molecular weight of 441.47 g/mol. Its IUPAC name is 2-(2-pyridin-2-ylethyl)-2-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-3H-isoindol-2-ium-1-one.
| Compound Name | 2-(2-pyridin-2-ylethyl)-2-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-3H-isoindol-2-ium-1-one |
|---|---|
| PubChem CID | 87601747 |
| Molecular Formula | C25H24F3N2O2+ |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 2-(2-pyridin-2-ylethyl)-2-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-3H-isoindol-2-ium-1-one |
| SMILES | CC(c1ccc(OCC(F)(F)F)cc1)[N+]1(CCc2ccccn2)Cc2ccccc2C1=O |
| InChI | InChI=1S/C25H24F3N2O2/c1-18(19-9-11-22(12-10-19)32-17-25(26,27)28)30(15-13-21-7-4-5-14-29-21)16-20-6-2-3-8-23(20)24(30)31/h2-12,14,18H,13,15-17H2,1H3/q+1 |
| InChIKey | IOFNBDGYSNVQSO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|