About iron;[(Z)-octadec-9-enoxy]-[(Z)-octadec-9-enyl]phosphinic acid
iron;[(Z)-octadec-9-enoxy]-[(Z)-octadec-9-enyl]phosphinic acid (PubChem CID 87602188) has the molecular formula C36H71FeO3P
and a molecular weight of 638.78 g/mol. Its IUPAC name is iron;[(Z)-octadec-9-enoxy]-[(Z)-octadec-9-enyl]phosphinic acid.
Molecular Properties
| Compound Name | iron;[(Z)-octadec-9-enoxy]-[(Z)-octadec-9-enyl]phosphinic acid |
| PubChem CID | 87602188 |
| Molecular Formula | C36H71FeO3P |
| Molecular Weight | 638.78 g/mol |
| Exact Mass | 638.45 |
| IUPAC Name | iron;[(Z)-octadec-9-enoxy]-[(Z)-octadec-9-enyl]phosphinic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOP(=O)(O)CCCCCCCC/C=C\CCCCCCCC.[Fe] |
| InChI | InChI=1S/C36H71O3P.Fe/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39-40(37,38)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;/h17-20H,3-16,21-36H2,1-2H3,(H,37,38);/b19-17-,20-18-; |
| InChIKey | DVLKHTGEJLOXFR-AWLASTDMSA-N |
| XLogP | 13.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 638.78 |
| LogP ≤ 5 | 13.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze iron;[(Z)-octadec-9-enoxy]-[(Z)-octadec-9-enyl]phosphinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;[(Z)-octadec-9-enoxy]-[(Z)-octadec-9-enyl]phosphinic acid?
The IUPAC name of iron;[(Z)-octadec-9-enoxy]-[(Z)-octadec-9-enyl]phosphinic acid (CID 87602188) is iron;[(Z)-octadec-9-enoxy]-[(Z)-octadec-9-enyl]phosphinic acid.
What is the SMILES notation for iron;[(Z)-octadec-9-enoxy]-[(Z)-octadec-9-enyl]phosphinic acid?
The canonical SMILES for iron;[(Z)-octadec-9-enoxy]-[(Z)-octadec-9-enyl]phosphinic acid is CCCCCCCC/C=C\CCCCCCCCOP(=O)(O)CCCCCCCC/C=C\CCCCCCCC.[Fe].
What is the InChIKey of iron;[(Z)-octadec-9-enoxy]-[(Z)-octadec-9-enyl]phosphinic acid?
The InChIKey is DVLKHTGEJLOXFR-AWLASTDMSA-N. The full InChI is InChI=1S/C36H71O3P.Fe/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39-40(37,38)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;/h17-20H,3-16,21-36H2,1-2H3,(H,37,38);/b19-17-,20-18-;.
What are the key properties of iron;[(Z)-octadec-9-enoxy]-[(Z)-octadec-9-enyl]phosphinic acid?
iron;[(Z)-octadec-9-enoxy]-[(Z)-octadec-9-enyl]phosphinic acid has a molecular weight of 638.78 g/mol, XLogP of 13.26, 33 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iron;[(Z)-octadec-9-enoxy]-[(Z)-octadec-9-enyl]phosphinic acid is sourced from PubChem (CID 87602188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).