C24H16BrFN4O4S — CID 87602255
[2-bromo-7-[5-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-3-yl]-1,6-naphthyridin-8-yl] 4-methylbenzenesulfonate (PubChem CID 87602255) has the molecular formula C24H16BrFN4O4S and a molecular weight of 555.39 g/mol. Its IUPAC name is [2-bromo-7-[5-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-3-yl]-1,6-naphthyridin-8-yl] 4-methylbenzenesulfonate.
| Compound Name | [2-bromo-7-[5-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-3-yl]-1,6-naphthyridin-8-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87602255 |
| Molecular Formula | C24H16BrFN4O4S |
| Molecular Weight | 555.39 g/mol |
| Exact Mass | 554.01 |
| IUPAC Name | [2-bromo-7-[5-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-3-yl]-1,6-naphthyridin-8-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2c(-c3noc(Cc4ccc(F)cc4)n3)ncc3ccc(Br)nc23)cc1 |
| InChI | InChI=1S/C24H16BrFN4O4S/c1-14-2-9-18(10-3-14)35(31,32)34-23-21-16(6-11-19(25)28-21)13-27-22(23)24-29-20(33-30-24)12-15-4-7-17(26)8-5-15/h2-11,13H,12H2,1H3 |
| InChIKey | FUVCBMCWRHMAQR-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 108.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.39 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|