C52H60N10O6 — CID 87602706
bis[1-[(3S)-3-[2-[4-(1H-indol-5-yl)piperazin-1-yl]ethyl]-2,3-dihydroindol-1-yl]-2-(methylamino)-2-oxoethyl] oxalate (PubChem CID 87602706) has the molecular formula C52H60N10O6 and a molecular weight of 921.12 g/mol. Its IUPAC name is bis[1-[(3S)-3-[2-[4-(1H-indol-5-yl)piperazin-1-yl]ethyl]-2,3-dihydroindol-1-yl]-2-(methylamino)-2-oxoethyl] oxalate.
| Compound Name | bis[1-[(3S)-3-[2-[4-(1H-indol-5-yl)piperazin-1-yl]ethyl]-2,3-dihydroindol-1-yl]-2-(methylamino)-2-oxoethyl] oxalate |
|---|---|
| PubChem CID | 87602706 |
| Molecular Formula | C52H60N10O6 |
| Molecular Weight | 921.12 g/mol |
| Exact Mass | 920.47 |
| IUPAC Name | bis[1-[(3S)-3-[2-[4-(1H-indol-5-yl)piperazin-1-yl]ethyl]-2,3-dihydroindol-1-yl]-2-(methylamino)-2-oxoethyl] oxalate |
| SMILES | CNC(=O)C(OC(=O)C(=O)OC(C(=O)NC)N1C[C@@H](CCN2CCN(c3ccc4[nH]ccc4c3)CC2)c2ccccc21)N1C[C@@H](CCN2CCN(c3ccc4[nH]ccc4c3)CC2)c2ccccc21 |
| InChI | InChI=1S/C52H60N10O6/c1-53-47(63)49(61-33-37(41-7-3-5-9-45(41)61)17-21-57-23-27-59(28-24-57)39-11-13-43-35(31-39)15-19-55-43)67-51(65)52(66)68-50(48(64)54-2)62-34-38(42-8-4-6-10-46(42)62)18-22-58-25-29-60(30-26-58)40-12-14-44-36(32-40)16-20-56-44/h3-16,19-20,31-32,37-38,49-50,55-56H,17-18,21-30,33-34H2,1-2H3,(H,53,63)(H,54,64)/t37-,38-,49?,50?/m1/s1 |
| InChIKey | JGUMIBVDTQRPMH-LTKBBMDHSA-N |
| XLogP | 4.81 |
| TPSA | 161.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.12 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|