C25H21F9O4S2 — CID 87602803
[1-(4-phenylmethoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 87602803) has the molecular formula C25H21F9O4S2 and a molecular weight of 620.56 g/mol. Its IUPAC name is [1-(4-phenylmethoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [1-(4-phenylmethoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 87602803 |
| Molecular Formula | C25H21F9O4S2 |
| Molecular Weight | 620.56 g/mol |
| Exact Mass | 620.07 |
| IUPAC Name | [1-(4-phenylmethoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)(OS1(c2ccc(OCc3ccccc3)c3ccccc23)CCCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H21F9O4S2/c26-22(27,24(30,31)32)23(28,29)25(33,34)40(35,36)38-39(14-6-7-15-39)21-13-12-20(18-10-4-5-11-19(18)21)37-16-17-8-2-1-3-9-17/h1-5,8-13H,6-7,14-16H2 |
| InChIKey | MEWUJABSJWGTNC-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.56 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|