C50H54F2N10O6 — CID 87602956
bis[2-amino-1-[(3S)-3-[2-[4-(7-fluoro-1H-indol-5-yl)piperazin-1-yl]ethyl]-2,3-dihydroindol-1-yl]-2-oxoethyl] oxalate (PubChem CID 87602956) has the molecular formula C50H54F2N10O6 and a molecular weight of 929.04 g/mol. Its IUPAC name is bis[2-amino-1-[(3S)-3-[2-[4-(7-fluoro-1H-indol-5-yl)piperazin-1-yl]ethyl]-2,3-dihydroindol-1-yl]-2-oxoethyl] oxalate.
| Compound Name | bis[2-amino-1-[(3S)-3-[2-[4-(7-fluoro-1H-indol-5-yl)piperazin-1-yl]ethyl]-2,3-dihydroindol-1-yl]-2-oxoethyl] oxalate |
|---|---|
| PubChem CID | 87602956 |
| Molecular Formula | C50H54F2N10O6 |
| Molecular Weight | 929.04 g/mol |
| Exact Mass | 928.42 |
| IUPAC Name | bis[2-amino-1-[(3S)-3-[2-[4-(7-fluoro-1H-indol-5-yl)piperazin-1-yl]ethyl]-2,3-dihydroindol-1-yl]-2-oxoethyl] oxalate |
| SMILES | NC(=O)C(OC(=O)C(=O)OC(C(N)=O)N1C[C@@H](CCN2CCN(c3cc(F)c4[nH]ccc4c3)CC2)c2ccccc21)N1C[C@@H](CCN2CCN(c3cc(F)c4[nH]ccc4c3)CC2)c2ccccc21 |
| InChI | InChI=1S/C50H54F2N10O6/c51-39-27-35(25-31-9-13-55-43(31)39)59-21-17-57(18-22-59)15-11-33-29-61(41-7-3-1-5-37(33)41)47(45(53)63)67-49(65)50(66)68-48(46(54)64)62-30-34(38-6-2-4-8-42(38)62)12-16-58-19-23-60(24-20-58)36-26-32-10-14-56-44(32)40(52)28-36/h1-10,13-14,25-28,33-34,47-48,55-56H,11-12,15-24,29-30H2,(H2,53,63)(H2,54,64)/t33-,34-,47?,48?/m1/s1 |
| InChIKey | VLFQYUUMOZKLJM-LZZKPDSGSA-N |
| XLogP | 4.57 |
| TPSA | 189.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.04 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|