About fluoro 2-[[1-(2-chloropyrimidin-4-yl)piperidin-4-yl]amino]-2,2-difluoroacetate
fluoro 2-[[1-(2-chloropyrimidin-4-yl)piperidin-4-yl]amino]-2,2-difluoroacetate (PubChem CID 87603148) has the molecular formula C11H12ClF3N4O2
and a molecular weight of 324.69 g/mol. Its IUPAC name is fluoro 2-[[1-(2-chloropyrimidin-4-yl)piperidin-4-yl]amino]-2,2-difluoroacetate.
Molecular Properties
| Compound Name | fluoro 2-[[1-(2-chloropyrimidin-4-yl)piperidin-4-yl]amino]-2,2-difluoroacetate |
| PubChem CID | 87603148 |
| Molecular Formula | C11H12ClF3N4O2 |
| Molecular Weight | 324.69 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | fluoro 2-[[1-(2-chloropyrimidin-4-yl)piperidin-4-yl]amino]-2,2-difluoroacetate |
| SMILES | O=C(OF)C(F)(F)NC1CCN(c2ccnc(Cl)n2)CC1 |
| InChI | InChI=1S/C11H12ClF3N4O2/c12-10-16-4-1-8(17-10)19-5-2-7(3-6-19)18-11(13,14)9(20)21-15/h1,4,7,18H,2-3,5-6H2 |
| InChIKey | OZSZKHQREVBNLV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.69 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze fluoro 2-[[1-(2-chloropyrimidin-4-yl)piperidin-4-yl]amino]-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro 2-[[1-(2-chloropyrimidin-4-yl)piperidin-4-yl]amino]-2,2-difluoroacetate?
The IUPAC name of fluoro 2-[[1-(2-chloropyrimidin-4-yl)piperidin-4-yl]amino]-2,2-difluoroacetate (CID 87603148) is fluoro 2-[[1-(2-chloropyrimidin-4-yl)piperidin-4-yl]amino]-2,2-difluoroacetate.
What is the SMILES notation for fluoro 2-[[1-(2-chloropyrimidin-4-yl)piperidin-4-yl]amino]-2,2-difluoroacetate?
The canonical SMILES for fluoro 2-[[1-(2-chloropyrimidin-4-yl)piperidin-4-yl]amino]-2,2-difluoroacetate is O=C(OF)C(F)(F)NC1CCN(c2ccnc(Cl)n2)CC1.
What is the InChIKey of fluoro 2-[[1-(2-chloropyrimidin-4-yl)piperidin-4-yl]amino]-2,2-difluoroacetate?
The InChIKey is OZSZKHQREVBNLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClF3N4O2/c12-10-16-4-1-8(17-10)19-5-2-7(3-6-19)18-11(13,14)9(20)21-15/h1,4,7,18H,2-3,5-6H2.
What are the key properties of fluoro 2-[[1-(2-chloropyrimidin-4-yl)piperidin-4-yl]amino]-2,2-difluoroacetate?
fluoro 2-[[1-(2-chloropyrimidin-4-yl)piperidin-4-yl]amino]-2,2-difluoroacetate has a molecular weight of 324.69 g/mol, XLogP of 1.71, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro 2-[[1-(2-chloropyrimidin-4-yl)piperidin-4-yl]amino]-2,2-difluoroacetate is sourced from PubChem (CID 87603148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).