C40H44Cl2F6N6O2 — CID 87603596
1,2-bis[1-[(4-chloro-3-ethoxyphenyl)methyl]piperidin-4-yl]-1-[3-(trifluoromethyl)-2-pyridinyl]-2-[5-(trifluoromethyl)-2-pyridinyl]hydrazine (PubChem CID 87603596) has the molecular formula C40H44Cl2F6N6O2 and a molecular weight of 825.73 g/mol. Its IUPAC name is 1,2-bis[1-[(4-chloro-3-ethoxyphenyl)methyl]piperidin-4-yl]-1-[3-(trifluoromethyl)-2-pyridinyl]-2-[5-(trifluoromethyl)-2-pyridinyl]hydrazine.
| Compound Name | 1,2-bis[1-[(4-chloro-3-ethoxyphenyl)methyl]piperidin-4-yl]-1-[3-(trifluoromethyl)-2-pyridinyl]-2-[5-(trifluoromethyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 87603596 |
| Molecular Formula | C40H44Cl2F6N6O2 |
| Molecular Weight | 825.73 g/mol |
| Exact Mass | 824.28 |
| IUPAC Name | 1,2-bis[1-[(4-chloro-3-ethoxyphenyl)methyl]piperidin-4-yl]-1-[3-(trifluoromethyl)-2-pyridinyl]-2-[5-(trifluoromethyl)-2-pyridinyl]hydrazine |
| SMILES | CCOc1cc(CN2CCC(N(c3ccc(C(F)(F)F)cn3)N(c3ncccc3C(F)(F)F)C3CCN(Cc4ccc(Cl)c(OCC)c4)CC3)CC2)ccc1Cl |
| InChI | InChI=1S/C40H44Cl2F6N6O2/c1-3-55-35-22-27(7-10-33(35)41)25-51-18-13-30(14-19-51)53(37-12-9-29(24-50-37)39(43,44)45)54(38-32(40(46,47)48)6-5-17-49-38)31-15-20-52(21-16-31)26-28-8-11-34(42)36(23-28)56-4-2/h5-12,17,22-24,30-31H,3-4,13-16,18-21,25-26H2,1-2H3 |
| InChIKey | HNZGQUKULSHUMO-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.73 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|