About 4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-2-cyclohexyl-3-methoxy-5,6-dimethylbenzoic acid
4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-2-cyclohexyl-3-methoxy-5,6-dimethylbenzoic acid (PubChem CID 87603829) has the molecular formula C25H27BrO4
and a molecular weight of 471.39 g/mol. Its IUPAC name is 4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-2-cyclohexyl-3-methoxy-5,6-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-2-cyclohexyl-3-methoxy-5,6-dimethylbenzoic acid |
| PubChem CID | 87603829 |
| Molecular Formula | C25H27BrO4 |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-2-cyclohexyl-3-methoxy-5,6-dimethylbenzoic acid |
| SMILES | COc1c(C=CC(=O)c2ccc(Br)cc2)c(C)c(C)c(C(=O)O)c1C1CCCCC1 |
| InChI | InChI=1S/C25H27BrO4/c1-15-16(2)22(25(28)29)23(18-7-5-4-6-8-18)24(30-3)20(15)13-14-21(27)17-9-11-19(26)12-10-17/h9-14,18H,4-8H2,1-3H3,(H,28,29) |
| InChIKey | WDJIUBHIGYKOQT-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-2-cyclohexyl-3-methoxy-5,6-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-2-cyclohexyl-3-methoxy-5,6-dimethylbenzoic acid?
The IUPAC name of 4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-2-cyclohexyl-3-methoxy-5,6-dimethylbenzoic acid (CID 87603829) is 4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-2-cyclohexyl-3-methoxy-5,6-dimethylbenzoic acid.
What is the SMILES notation for 4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-2-cyclohexyl-3-methoxy-5,6-dimethylbenzoic acid?
The canonical SMILES for 4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-2-cyclohexyl-3-methoxy-5,6-dimethylbenzoic acid is COc1c(C=CC(=O)c2ccc(Br)cc2)c(C)c(C)c(C(=O)O)c1C1CCCCC1.
What is the InChIKey of 4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-2-cyclohexyl-3-methoxy-5,6-dimethylbenzoic acid?
The InChIKey is WDJIUBHIGYKOQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27BrO4/c1-15-16(2)22(25(28)29)23(18-7-5-4-6-8-18)24(30-3)20(15)13-14-21(27)17-9-11-19(26)12-10-17/h9-14,18H,4-8H2,1-3H3,(H,28,29).
What are the key properties of 4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-2-cyclohexyl-3-methoxy-5,6-dimethylbenzoic acid?
4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-2-cyclohexyl-3-methoxy-5,6-dimethylbenzoic acid has a molecular weight of 471.39 g/mol, XLogP of 6.72, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4-bromophenyl)-3-oxoprop-1-enyl]-2-cyclohexyl-3-methoxy-5,6-dimethylbenzoic acid is sourced from PubChem (CID 87603829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).