C29H21F17O4S2 — CID 87603892
[1-(4-phenylmethoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate (PubChem CID 87603892) has the molecular formula C29H21F17O4S2 and a molecular weight of 820.58 g/mol. Its IUPAC name is [1-(4-phenylmethoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate.
| Compound Name | [1-(4-phenylmethoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 87603892 |
| Molecular Formula | C29H21F17O4S2 |
| Molecular Weight | 820.58 g/mol |
| Exact Mass | 820.06 |
| IUPAC Name | [1-(4-phenylmethoxynaphthalen-1-yl)thiolan-1-yl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
| SMILES | O=S(=O)(OS1(c2ccc(OCc3ccccc3)c3ccccc23)CCCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C29H21F17O4S2/c30-22(31,24(34,35)26(38,39)28(42,43)44)23(32,33)25(36,37)27(40,41)29(45,46)52(47,48)50-51(14-6-7-15-51)21-13-12-20(18-10-4-5-11-19(18)21)49-16-17-8-2-1-3-9-17/h1-5,8-13H,6-7,14-16H2 |
| InChIKey | YRJUCNKQPXJBPW-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.58 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|