C27H23F17O6S2 — CID 87603896
[1-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]naphthalen-1-yl]thiolan-1-yl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate (PubChem CID 87603896) has the molecular formula C27H23F17O6S2 and a molecular weight of 830.57 g/mol. Its IUPAC name is [1-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]naphthalen-1-yl]thiolan-1-yl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate.
| Compound Name | [1-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]naphthalen-1-yl]thiolan-1-yl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 87603896 |
| Molecular Formula | C27H23F17O6S2 |
| Molecular Weight | 830.57 g/mol |
| Exact Mass | 830.07 |
| IUPAC Name | [1-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]naphthalen-1-yl]thiolan-1-yl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
| SMILES | CC(C)(C)OC(=O)Oc1ccc(S2(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCC2)c2ccccc12 |
| InChI | InChI=1S/C27H23F17O6S2/c1-19(2,3)49-18(45)48-16-10-11-17(15-9-5-4-8-14(15)16)51(12-6-7-13-51)50-52(46,47)27(43,44)25(38,39)23(34,35)21(30,31)20(28,29)22(32,33)24(36,37)26(40,41)42/h4-5,8-11H,6-7,12-13H2,1-3H3 |
| InChIKey | GQQOSGFVCOSHAG-UHFFFAOYSA-N |
| XLogP | 10.34 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.57 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|