C20H20ClFN4O — CID 87604253
(6-chloropyrimidin-4-yl)-[6-fluoro-1-(3-pyrrolidin-1-ylpropyl)indol-3-yl]methanone (PubChem CID 87604253) has the molecular formula C20H20ClFN4O and a molecular weight of 386.86 g/mol. Its IUPAC name is (6-chloropyrimidin-4-yl)-[6-fluoro-1-(3-pyrrolidin-1-ylpropyl)indol-3-yl]methanone.
| Compound Name | (6-chloropyrimidin-4-yl)-[6-fluoro-1-(3-pyrrolidin-1-ylpropyl)indol-3-yl]methanone |
|---|---|
| PubChem CID | 87604253 |
| Molecular Formula | C20H20ClFN4O |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (6-chloropyrimidin-4-yl)-[6-fluoro-1-(3-pyrrolidin-1-ylpropyl)indol-3-yl]methanone |
| SMILES | O=C(c1cc(Cl)ncn1)c1cn(CCCN2CCCC2)c2cc(F)ccc12 |
| InChI | InChI=1S/C20H20ClFN4O/c21-19-11-17(23-13-24-19)20(27)16-12-26(9-3-8-25-6-1-2-7-25)18-10-14(22)4-5-15(16)18/h4-5,10-13H,1-3,6-9H2 |
| InChIKey | RZBPBQYAUJXTNV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |