About 2-(bromomethyl)cyclohexa-2,4-diene-1-thione
2-(bromomethyl)cyclohexa-2,4-diene-1-thione (PubChem CID 87605070) has the molecular formula C7H7BrS
and a molecular weight of 203.10 g/mol. Its IUPAC name is 2-(bromomethyl)cyclohexa-2,4-diene-1-thione.
Molecular Properties
| Compound Name | 2-(bromomethyl)cyclohexa-2,4-diene-1-thione |
| PubChem CID | 87605070 |
| Molecular Formula | C7H7BrS |
| Molecular Weight | 203.10 g/mol |
| Exact Mass | 201.95 |
| IUPAC Name | 2-(bromomethyl)cyclohexa-2,4-diene-1-thione |
| SMILES | S=C1CC=CC=C1CBr |
| InChI | InChI=1S/C7H7BrS/c8-5-6-3-1-2-4-7(6)9/h1-3H,4-5H2 |
| InChIKey | HACCHVVCWWELBA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.10 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)cyclohexa-2,4-diene-1-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)cyclohexa-2,4-diene-1-thione?
The IUPAC name of 2-(bromomethyl)cyclohexa-2,4-diene-1-thione (CID 87605070) is 2-(bromomethyl)cyclohexa-2,4-diene-1-thione.
What is the SMILES notation for 2-(bromomethyl)cyclohexa-2,4-diene-1-thione?
The canonical SMILES for 2-(bromomethyl)cyclohexa-2,4-diene-1-thione is S=C1CC=CC=C1CBr.
What is the InChIKey of 2-(bromomethyl)cyclohexa-2,4-diene-1-thione?
The InChIKey is HACCHVVCWWELBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrS/c8-5-6-3-1-2-4-7(6)9/h1-3H,4-5H2.
What are the key properties of 2-(bromomethyl)cyclohexa-2,4-diene-1-thione?
2-(bromomethyl)cyclohexa-2,4-diene-1-thione has a molecular weight of 203.10 g/mol, XLogP of 2.64, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)cyclohexa-2,4-diene-1-thione is sourced from PubChem (CID 87605070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).