C51H52N2O4 — CID 87605196
methyl 3-cyclohexyl-2-(2-ethenylphenyl)-1H-indole-6-carboxylate;methyl 3-cyclohexyl-2-(2-ethenylphenyl)-1-prop-2-ynylindole-6-carboxylate (PubChem CID 87605196) has the molecular formula C51H52N2O4 and a molecular weight of 756.99 g/mol. Its IUPAC name is methyl 3-cyclohexyl-2-(2-ethenylphenyl)-1H-indole-6-carboxylate;methyl 3-cyclohexyl-2-(2-ethenylphenyl)-1-prop-2-ynylindole-6-carboxylate.
| Compound Name | methyl 3-cyclohexyl-2-(2-ethenylphenyl)-1H-indole-6-carboxylate;methyl 3-cyclohexyl-2-(2-ethenylphenyl)-1-prop-2-ynylindole-6-carboxylate |
|---|---|
| PubChem CID | 87605196 |
| Molecular Formula | C51H52N2O4 |
| Molecular Weight | 756.99 g/mol |
| Exact Mass | 756.39 |
| IUPAC Name | methyl 3-cyclohexyl-2-(2-ethenylphenyl)-1H-indole-6-carboxylate;methyl 3-cyclohexyl-2-(2-ethenylphenyl)-1-prop-2-ynylindole-6-carboxylate |
| SMILES | C#CCn1c(-c2ccccc2C=C)c(C2CCCCC2)c2ccc(C(=O)OC)cc21.C=Cc1ccccc1-c1[nH]c2cc(C(=O)OC)ccc2c1C1CCCCC1 |
| InChI | InChI=1S/C27H27NO2.C24H25NO2/c1-4-17-28-24-18-21(27(29)30-3)15-16-23(24)25(20-12-7-6-8-13-20)26(28)22-14-10-9-11-19(22)5-2;1-3-16-9-7-8-12-19(16)23-22(17-10-5-4-6-11-17)20-14-13-18(24(26)27-2)15-21(20)25-23/h1,5,9-11,14-16,18,20H,2,6-8,12-13,17H2,3H3;3,7-9,12-15,17,25H,1,4-6,10-11H2,2H3 |
| InChIKey | YJSJAMUBXTUTHC-UHFFFAOYSA-N |
| XLogP | 12.73 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.99 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|