About 1-[dimethyl(nitroso)-λ4-sulfanyl]-N-(2-methyl-3-nitrophenyl)formamide
1-[dimethyl(nitroso)-λ4-sulfanyl]-N-(2-methyl-3-nitrophenyl)formamide (PubChem CID 87606058) has the molecular formula C10H13N3O4S
and a molecular weight of 271.30 g/mol. Its IUPAC name is 1-[dimethyl(nitroso)-λ4-sulfanyl]-N-(2-methyl-3-nitrophenyl)formamide.
Molecular Properties
| Compound Name | 1-[dimethyl(nitroso)-λ4-sulfanyl]-N-(2-methyl-3-nitrophenyl)formamide |
| PubChem CID | 87606058 |
| Molecular Formula | C10H13N3O4S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 1-[dimethyl(nitroso)-λ4-sulfanyl]-N-(2-methyl-3-nitrophenyl)formamide |
| SMILES | Cc1c(NC(=O)S(C)(C)N=O)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H13N3O4S/c1-7-8(5-4-6-9(7)13(16)17)11-10(14)18(2,3)12-15/h4-6H,1-3H3,(H,11,14) |
| InChIKey | JXOSDOIAZRSSKZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 1-[dimethyl(nitroso)-λ4-sulfanyl]-N-(2-methyl-3-nitrophenyl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[dimethyl(nitroso)-λ4-sulfanyl]-N-(2-methyl-3-nitrophenyl)formamide?
The IUPAC name of 1-[dimethyl(nitroso)-λ4-sulfanyl]-N-(2-methyl-3-nitrophenyl)formamide (CID 87606058) is 1-[dimethyl(nitroso)-λ4-sulfanyl]-N-(2-methyl-3-nitrophenyl)formamide.
What is the SMILES notation for 1-[dimethyl(nitroso)-λ4-sulfanyl]-N-(2-methyl-3-nitrophenyl)formamide?
The canonical SMILES for 1-[dimethyl(nitroso)-λ4-sulfanyl]-N-(2-methyl-3-nitrophenyl)formamide is Cc1c(NC(=O)S(C)(C)N=O)cccc1[N+](=O)[O-].
What is the InChIKey of 1-[dimethyl(nitroso)-λ4-sulfanyl]-N-(2-methyl-3-nitrophenyl)formamide?
The InChIKey is JXOSDOIAZRSSKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O4S/c1-7-8(5-4-6-9(7)13(16)17)11-10(14)18(2,3)12-15/h4-6H,1-3H3,(H,11,14).
What are the key properties of 1-[dimethyl(nitroso)-λ4-sulfanyl]-N-(2-methyl-3-nitrophenyl)formamide?
1-[dimethyl(nitroso)-λ4-sulfanyl]-N-(2-methyl-3-nitrophenyl)formamide has a molecular weight of 271.30 g/mol, XLogP of 3.18, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[dimethyl(nitroso)-λ4-sulfanyl]-N-(2-methyl-3-nitrophenyl)formamide is sourced from PubChem (CID 87606058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).