C13H25N3O2S2 — CID 87606747
N-(5-aminopentyl)-1,1,3,5-tetramethyl-4-oxo-2-sulfanylidene-1,3-thiazolidine-5-carboxamide (PubChem CID 87606747) has the molecular formula C13H25N3O2S2 and a molecular weight of 319.50 g/mol. Its IUPAC name is N-(5-aminopentyl)-1,1,3,5-tetramethyl-4-oxo-2-sulfanylidene-1,3-thiazolidine-5-carboxamide.
| Compound Name | N-(5-aminopentyl)-1,1,3,5-tetramethyl-4-oxo-2-sulfanylidene-1,3-thiazolidine-5-carboxamide |
|---|---|
| PubChem CID | 87606747 |
| Molecular Formula | C13H25N3O2S2 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-(5-aminopentyl)-1,1,3,5-tetramethyl-4-oxo-2-sulfanylidene-1,3-thiazolidine-5-carboxamide |
| SMILES | CN1C(=O)C(C)(C(=O)NCCCCCN)S(C)(C)C1=S |
| InChI | InChI=1S/C13H25N3O2S2/c1-13(10(17)15-9-7-5-6-8-14)11(18)16(2)12(19)20(13,3)4/h5-9,14H2,1-4H3,(H,15,17) |
| InChIKey | YONFFLCCQVKHBY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|