C16H18ClN3O3 — CID 87607129
cyclobutylmethyl 1-carbamoyl-7-chloro-2,3-dimethylpyrrolo[2,3-c]pyridine-4-carboxylate (PubChem CID 87607129) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is cyclobutylmethyl 1-carbamoyl-7-chloro-2,3-dimethylpyrrolo[2,3-c]pyridine-4-carboxylate.
| Compound Name | cyclobutylmethyl 1-carbamoyl-7-chloro-2,3-dimethylpyrrolo[2,3-c]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 87607129 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | cyclobutylmethyl 1-carbamoyl-7-chloro-2,3-dimethylpyrrolo[2,3-c]pyridine-4-carboxylate |
| SMILES | Cc1c(C)n(C(N)=O)c2c(Cl)ncc(C(=O)OCC3CCC3)c12 |
| InChI | InChI=1S/C16H18ClN3O3/c1-8-9(2)20(16(18)22)13-12(8)11(6-19-14(13)17)15(21)23-7-10-4-3-5-10/h6,10H,3-5,7H2,1-2H3,(H2,18,22) |
| InChIKey | XLUNCGJQTIJHKB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|