C23H22F3N3O4S — CID 87607135
2-(3-methylsulfonylphenyl)-6-morpholin-4-yl-N-(2,3,5-trifluoro-4-methoxyphenyl)pyridin-4-amine (PubChem CID 87607135) has the molecular formula C23H22F3N3O4S and a molecular weight of 493.51 g/mol. Its IUPAC name is 2-(3-methylsulfonylphenyl)-6-morpholin-4-yl-N-(2,3,5-trifluoro-4-methoxyphenyl)pyridin-4-amine.
| Compound Name | 2-(3-methylsulfonylphenyl)-6-morpholin-4-yl-N-(2,3,5-trifluoro-4-methoxyphenyl)pyridin-4-amine |
|---|---|
| PubChem CID | 87607135 |
| Molecular Formula | C23H22F3N3O4S |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 2-(3-methylsulfonylphenyl)-6-morpholin-4-yl-N-(2,3,5-trifluoro-4-methoxyphenyl)pyridin-4-amine |
| SMILES | COc1c(F)cc(Nc2cc(-c3cccc(S(C)(=O)=O)c3)nc(N3CCOCC3)c2)c(F)c1F |
| InChI | InChI=1S/C23H22F3N3O4S/c1-32-23-17(24)13-19(21(25)22(23)26)27-15-11-18(14-4-3-5-16(10-14)34(2,30)31)28-20(12-15)29-6-8-33-9-7-29/h3-5,10-13H,6-9H2,1-2H3,(H,27,28) |
| InChIKey | GABKXIAETTYXPL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|