C26H21F3N4O3S — CID 87607206
ethyl 1-[6-[2-[(4-carbamothioylphenyl)methoxy]phenyl]-2-pyridinyl]-5-(trifluoromethyl)pyrazole-4-carboxylate (PubChem CID 87607206) has the molecular formula C26H21F3N4O3S and a molecular weight of 526.54 g/mol. Its IUPAC name is ethyl 1-[6-[2-[(4-carbamothioylphenyl)methoxy]phenyl]-2-pyridinyl]-5-(trifluoromethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[6-[2-[(4-carbamothioylphenyl)methoxy]phenyl]-2-pyridinyl]-5-(trifluoromethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 87607206 |
| Molecular Formula | C26H21F3N4O3S |
| Molecular Weight | 526.54 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | ethyl 1-[6-[2-[(4-carbamothioylphenyl)methoxy]phenyl]-2-pyridinyl]-5-(trifluoromethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2cccc(-c3ccccc3OCc3ccc(C(N)=S)cc3)n2)c1C(F)(F)F |
| InChI | InChI=1S/C26H21F3N4O3S/c1-2-35-25(34)19-14-31-33(23(19)26(27,28)29)22-9-5-7-20(32-22)18-6-3-4-8-21(18)36-15-16-10-12-17(13-11-16)24(30)37/h3-14H,2,15H2,1H3,(H2,30,37) |
| InChIKey | PATJUBILRNDGQU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|