C27H35N5O2 — CID 87607302
2-[3-[2-[5-(4,6-dimethylpyrimidine-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethyl]-3-phenylpyrrolidin-1-yl]acetaldehyde (PubChem CID 87607302) has the molecular formula C27H35N5O2 and a molecular weight of 461.61 g/mol. Its IUPAC name is 2-[3-[2-[5-(4,6-dimethylpyrimidine-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethyl]-3-phenylpyrrolidin-1-yl]acetaldehyde.
| Compound Name | 2-[3-[2-[5-(4,6-dimethylpyrimidine-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethyl]-3-phenylpyrrolidin-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 87607302 |
| Molecular Formula | C27H35N5O2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | 2-[3-[2-[5-(4,6-dimethylpyrimidine-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethyl]-3-phenylpyrrolidin-1-yl]acetaldehyde |
| SMILES | Cc1ncnc(C)c1C(=O)N1CC2CN(CCC3(c4ccccc4)CCN(CC=O)C3)CC2C1 |
| InChI | InChI=1S/C27H35N5O2/c1-20-25(21(2)29-19-28-20)26(34)32-16-22-14-31(15-23(22)17-32)11-9-27(24-6-4-3-5-7-24)8-10-30(18-27)12-13-33/h3-7,13,19,22-23H,8-12,14-18H2,1-2H3 |
| InChIKey | OQYVCYGBRHYEPN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|