C31H42FN5O2 — CID 87607605
3-[4-[2-[5-(4,6-dimethylpyrimidine-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethyl]-4-(3-fluorophenyl)piperidin-1-yl]-2,2-dimethylpropanal (PubChem CID 87607605) has the molecular formula C31H42FN5O2 and a molecular weight of 535.71 g/mol. Its IUPAC name is 3-[4-[2-[5-(4,6-dimethylpyrimidine-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethyl]-4-(3-fluorophenyl)piperidin-1-yl]-2,2-dimethylpropanal.
| Compound Name | 3-[4-[2-[5-(4,6-dimethylpyrimidine-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethyl]-4-(3-fluorophenyl)piperidin-1-yl]-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 87607605 |
| Molecular Formula | C31H42FN5O2 |
| Molecular Weight | 535.71 g/mol |
| Exact Mass | 535.33 |
| IUPAC Name | 3-[4-[2-[5-(4,6-dimethylpyrimidine-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]ethyl]-4-(3-fluorophenyl)piperidin-1-yl]-2,2-dimethylpropanal |
| SMILES | Cc1ncnc(C)c1C(=O)N1CC2CN(CCC3(c4cccc(F)c4)CCN(CC(C)(C)C=O)CC3)CC2C1 |
| InChI | InChI=1S/C31H42FN5O2/c1-22-28(23(2)34-21-33-22)29(39)37-17-24-15-36(16-25(24)18-37)13-10-31(26-6-5-7-27(32)14-26)8-11-35(12-9-31)19-30(3,4)20-38/h5-7,14,20-21,24-25H,8-13,15-19H2,1-4H3 |
| InChIKey | BIHXWIUATZTIJQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.71 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|