C13H24O5S — CID 87607910
2-[(1R,3R)-2,2-dimethyl-3-(2-methyl-1,3-dioxolan-2-yl)cyclobutyl]ethyl methanesulfonate (PubChem CID 87607910) has the molecular formula C13H24O5S and a molecular weight of 292.40 g/mol. Its IUPAC name is 2-[(1R,3R)-2,2-dimethyl-3-(2-methyl-1,3-dioxolan-2-yl)cyclobutyl]ethyl methanesulfonate.
| Compound Name | 2-[(1R,3R)-2,2-dimethyl-3-(2-methyl-1,3-dioxolan-2-yl)cyclobutyl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 87607910 |
| Molecular Formula | C13H24O5S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-[(1R,3R)-2,2-dimethyl-3-(2-methyl-1,3-dioxolan-2-yl)cyclobutyl]ethyl methanesulfonate |
| SMILES | CC1([C@@H]2C[C@H](CCOS(C)(=O)=O)C2(C)C)OCCO1 |
| InChI | InChI=1S/C13H24O5S/c1-12(2)10(5-6-18-19(4,14)15)9-11(12)13(3)16-7-8-17-13/h10-11H,5-9H2,1-4H3/t10-,11+/m0/s1 |
| InChIKey | JJVVGCNTNDTQPR-WDEREUQCSA-N |
| XLogP | 1.78 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|