C11H10F6 — CID 87608464
4-(1,1,1,2,3,3-hexafluoropropan-2-yl)-1,2-dimethylbenzene (PubChem CID 87608464) has the molecular formula C11H10F6 and a molecular weight of 256.19 g/mol. Its IUPAC name is 4-(1,1,1,2,3,3-hexafluoropropan-2-yl)-1,2-dimethylbenzene.
| Compound Name | 4-(1,1,1,2,3,3-hexafluoropropan-2-yl)-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 87608464 |
| Molecular Formula | C11H10F6 |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 4-(1,1,1,2,3,3-hexafluoropropan-2-yl)-1,2-dimethylbenzene |
| SMILES | Cc1ccc(C(F)(C(F)F)C(F)(F)F)cc1C |
| InChI | InChI=1S/C11H10F6/c1-6-3-4-8(5-7(6)2)10(14,9(12)13)11(15,16)17/h3-5,9H,1-2H3 |
| InChIKey | UROWOHRYOAHKBC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |