C34H27ClFN5O5S2 — CID 87608589
N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-7-methoxy-6-[2-[2-(2-pyridin-2-yl-2-sulfonylethoxy)ethyl]-1,3-thiazol-4-yl]quinazolin-4-amine (PubChem CID 87608589) has the molecular formula C34H27ClFN5O5S2 and a molecular weight of 704.21 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-7-methoxy-6-[2-[2-(2-pyridin-2-yl-2-sulfonylethoxy)ethyl]-1,3-thiazol-4-yl]quinazolin-4-amine.
| Compound Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-7-methoxy-6-[2-[2-(2-pyridin-2-yl-2-sulfonylethoxy)ethyl]-1,3-thiazol-4-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 87608589 |
| Molecular Formula | C34H27ClFN5O5S2 |
| Molecular Weight | 704.21 g/mol |
| Exact Mass | 703.11 |
| IUPAC Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-7-methoxy-6-[2-[2-(2-pyridin-2-yl-2-sulfonylethoxy)ethyl]-1,3-thiazol-4-yl]quinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2cc1-c1csc(CCOCC(c2ccccn2)=S(=O)=O)n1 |
| InChI | InChI=1S/C34H27ClFN5O5S2/c1-44-31-16-28-25(15-24(31)29-19-47-33(41-29)10-12-45-18-32(48(42)43)27-7-2-3-11-37-27)34(39-20-38-28)40-23-8-9-30(26(35)14-23)46-17-21-5-4-6-22(36)13-21/h2-9,11,13-16,19-20H,10,12,17-18H2,1H3,(H,38,39,40) |
| InChIKey | KQPHTTDZKKLGFU-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.21 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|