C5H11ClF2N2 — CID 87608597
2,2,6,6-tetradeuterio-4,4-difluoropiperidin-1-amine;hydrochloride (PubChem CID 87608597) has the molecular formula C5H11ClF2N2 and a molecular weight of 176.63 g/mol. Its IUPAC name is 2,2,6,6-tetradeuterio-4,4-difluoropiperidin-1-amine;hydrochloride.
| Compound Name | 2,2,6,6-tetradeuterio-4,4-difluoropiperidin-1-amine;hydrochloride |
|---|---|
| PubChem CID | 87608597 |
| Molecular Formula | C5H11ClF2N2 |
| Molecular Weight | 176.63 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 2,2,6,6-tetradeuterio-4,4-difluoropiperidin-1-amine;hydrochloride |
| SMILES | Cl.[2H]C1([2H])CC(F)(F)CC([2H])([2H])N1N |
| InChI | InChI=1S/C5H10F2N2.ClH/c6-5(7)1-3-9(8)4-2-5;/h1-4,8H2;1H/i3D2,4D2; |
| InChIKey | LGGVLGIRPRCSTN-URZLSVTISA-N |
| XLogP | 1.01 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.63 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|