About azane;(E)-N,N-dimethylprop-1-en-1-amine
azane;(E)-N,N-dimethylprop-1-en-1-amine (PubChem CID 87609233) has the molecular formula C5H17N3
and a molecular weight of 119.21 g/mol. Its IUPAC name is azane;(E)-N,N-dimethylprop-1-en-1-amine.
Molecular Properties
| Compound Name | azane;(E)-N,N-dimethylprop-1-en-1-amine |
| PubChem CID | 87609233 |
| Molecular Formula | C5H17N3 |
| Molecular Weight | 119.21 g/mol |
| Exact Mass | 119.14 |
| IUPAC Name | azane;(E)-N,N-dimethylprop-1-en-1-amine |
| SMILES | C/C=C/N(C)C.N.N |
| InChI | InChI=1S/C5H11N.2H3N/c1-4-5-6(2)3;;/h4-5H,1-3H3;2*1H3/b5-4+;; |
| InChIKey | LFMYGDBTLKZGDO-SFKRKKMESA-N |
| XLogP | 1.41 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;(E)-N,N-dimethylprop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;(E)-N,N-dimethylprop-1-en-1-amine?
The IUPAC name of azane;(E)-N,N-dimethylprop-1-en-1-amine (CID 87609233) is azane;(E)-N,N-dimethylprop-1-en-1-amine.
What is the SMILES notation for azane;(E)-N,N-dimethylprop-1-en-1-amine?
The canonical SMILES for azane;(E)-N,N-dimethylprop-1-en-1-amine is C/C=C/N(C)C.N.N.
What is the InChIKey of azane;(E)-N,N-dimethylprop-1-en-1-amine?
The InChIKey is LFMYGDBTLKZGDO-SFKRKKMESA-N. The full InChI is InChI=1S/C5H11N.2H3N/c1-4-5-6(2)3;;/h4-5H,1-3H3;2*1H3/b5-4+;;.
What are the key properties of azane;(E)-N,N-dimethylprop-1-en-1-amine?
azane;(E)-N,N-dimethylprop-1-en-1-amine has a molecular weight of 119.21 g/mol, XLogP of 1.41, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(E)-N,N-dimethylprop-1-en-1-amine is sourced from PubChem (CID 87609233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).