C13H13NO3S2 — CID 87609559
3-[(2,2-dimethyl-1,3-benzodioxol-5-yl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 87609559) has the molecular formula C13H13NO3S2 and a molecular weight of 295.39 g/mol. Its IUPAC name is 3-[(2,2-dimethyl-1,3-benzodioxol-5-yl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-[(2,2-dimethyl-1,3-benzodioxol-5-yl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 87609559 |
| Molecular Formula | C13H13NO3S2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 3-[(2,2-dimethyl-1,3-benzodioxol-5-yl)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC1(C)Oc2ccc(CN3C(=O)CSC3=S)cc2O1 |
| InChI | InChI=1S/C13H13NO3S2/c1-13(2)16-9-4-3-8(5-10(9)17-13)6-14-11(15)7-19-12(14)18/h3-5H,6-7H2,1-2H3 |
| InChIKey | KJWWNPIJHUOLPM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|