C12H3Cl8N3O3 — CID 87609850
1-(3,4-dichlorophenyl)-5-(trichloromethyl)-1,2,4-triazole-3-carbonyl chloride;oxalyl dichloride (PubChem CID 87609850) has the molecular formula C12H3Cl8N3O3 and a molecular weight of 520.80 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-5-(trichloromethyl)-1,2,4-triazole-3-carbonyl chloride;oxalyl dichloride.
| Compound Name | 1-(3,4-dichlorophenyl)-5-(trichloromethyl)-1,2,4-triazole-3-carbonyl chloride;oxalyl dichloride |
|---|---|
| PubChem CID | 87609850 |
| Molecular Formula | C12H3Cl8N3O3 |
| Molecular Weight | 520.80 g/mol |
| Exact Mass | 516.77 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-5-(trichloromethyl)-1,2,4-triazole-3-carbonyl chloride;oxalyl dichloride |
| SMILES | O=C(Cl)C(=O)Cl.O=C(Cl)c1nc(C(Cl)(Cl)Cl)n(-c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C10H3Cl6N3O.C2Cl2O2/c11-5-2-1-4(3-6(5)12)19-9(10(14,15)16)17-8(18-19)7(13)20;3-1(5)2(4)6/h1-3H; |
| InChIKey | PZCDVKLGELBMBV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 81.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.80 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|