About N-benzyl-4-[(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline
N-benzyl-4-[(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline (PubChem CID 87610236) has the molecular formula C19H21N4S+
and a molecular weight of 337.47 g/mol. Its IUPAC name is N-benzyl-4-[(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline.
Molecular Properties
| Compound Name | N-benzyl-4-[(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline |
| PubChem CID | 87610236 |
| Molecular Formula | C19H21N4S+ |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-benzyl-4-[(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline |
| SMILES | Cc1csc(/N=N/c2ccc(N(C)Cc3ccccc3)cc2)[n+]1C |
| InChI | InChI=1S/C19H21N4S/c1-15-14-24-19(23(15)3)21-20-17-9-11-18(12-10-17)22(2)13-16-7-5-4-6-8-16/h4-12,14H,13H2,1-3H3/q+1 |
| InChIKey | QGMRWJPEMMXYCR-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-4-[(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-4-[(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline?
The IUPAC name of N-benzyl-4-[(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline (CID 87610236) is N-benzyl-4-[(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline.
What is the SMILES notation for N-benzyl-4-[(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline?
The canonical SMILES for N-benzyl-4-[(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline is Cc1csc(/N=N/c2ccc(N(C)Cc3ccccc3)cc2)[n+]1C.
What is the InChIKey of N-benzyl-4-[(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline?
The InChIKey is QGMRWJPEMMXYCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N4S/c1-15-14-24-19(23(15)3)21-20-17-9-11-18(12-10-17)22(2)13-16-7-5-4-6-8-16/h4-12,14H,13H2,1-3H3/q+1.
What are the key properties of N-benzyl-4-[(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline?
N-benzyl-4-[(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline has a molecular weight of 337.47 g/mol, XLogP of 4.93, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4-[(3,4-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]-N-methylaniline is sourced from PubChem (CID 87610236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).