C24H30N4O2S — CID 87610299
N-benzyl-N-ethyl-3-methyl-4-[(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline acetate (PubChem CID 87610299) has the molecular formula C24H30N4O2S and a molecular weight of 438.60 g/mol. Its IUPAC name is N-benzyl-N-ethyl-3-methyl-4-[(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline acetate.
| Compound Name | N-benzyl-N-ethyl-3-methyl-4-[(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline acetate |
|---|---|
| PubChem CID | 87610299 |
| Molecular Formula | C24H30N4O2S |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | N-benzyl-N-ethyl-3-methyl-4-[(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline acetate |
| SMILES | CC(=O)[O-].CCN(Cc1ccccc1)c1ccc(/N=N/c2sc(C)c(C)[n+]2C)c(C)c1 |
| InChI | InChI=1S/C22H27N4S.C2H4O2/c1-6-26(15-19-10-8-7-9-11-19)20-12-13-21(16(2)14-20)23-24-22-25(5)17(3)18(4)27-22;1-2(3)4/h7-14H,6,15H2,1-5H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | PIEUVUJGJLHGCN-UHFFFAOYSA-M |
| XLogP | 4.70 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|