About carbanide;2,5-dimethyl-2-prop-2-enylpyrrole;iron(3+)
carbanide;2,5-dimethyl-2-prop-2-enylpyrrole;iron(3+) (PubChem CID 87610367) has the molecular formula C11H18FeN
and a molecular weight of 220.12 g/mol. Its IUPAC name is carbanide;2,5-dimethyl-2-prop-2-enylpyrrole;iron(3+).
Molecular Properties
| Compound Name | carbanide;2,5-dimethyl-2-prop-2-enylpyrrole;iron(3+) |
| PubChem CID | 87610367 |
| Molecular Formula | C11H18FeN |
| Molecular Weight | 220.12 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | carbanide;2,5-dimethyl-2-prop-2-enylpyrrole;iron(3+) |
| SMILES | C=C[CH-]C1(C)C=CC(C)=N1.[CH3-].[CH3-].[Fe+3] |
| InChI | InChI=1S/C9H12N.2CH3.Fe/c1-4-6-9(3)7-5-8(2)10-9;;;/h4-7H,1H2,2-3H3;2*1H3;/q3*-1;+3 |
| InChIKey | BECDHWZIQXEWER-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.12 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze carbanide;2,5-dimethyl-2-prop-2-enylpyrrole;iron(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;2,5-dimethyl-2-prop-2-enylpyrrole;iron(3+)?
The IUPAC name of carbanide;2,5-dimethyl-2-prop-2-enylpyrrole;iron(3+) (CID 87610367) is carbanide;2,5-dimethyl-2-prop-2-enylpyrrole;iron(3+).
What is the SMILES notation for carbanide;2,5-dimethyl-2-prop-2-enylpyrrole;iron(3+)?
The canonical SMILES for carbanide;2,5-dimethyl-2-prop-2-enylpyrrole;iron(3+) is C=C[CH-]C1(C)C=CC(C)=N1.[CH3-].[CH3-].[Fe+3].
What is the InChIKey of carbanide;2,5-dimethyl-2-prop-2-enylpyrrole;iron(3+)?
The InChIKey is BECDHWZIQXEWER-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N.2CH3.Fe/c1-4-6-9(3)7-5-8(2)10-9;;;/h4-7H,1H2,2-3H3;2*1H3;/q3*-1;+3.
What are the key properties of carbanide;2,5-dimethyl-2-prop-2-enylpyrrole;iron(3+)?
carbanide;2,5-dimethyl-2-prop-2-enylpyrrole;iron(3+) has a molecular weight of 220.12 g/mol, XLogP of 3.06, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;2,5-dimethyl-2-prop-2-enylpyrrole;iron(3+) is sourced from PubChem (CID 87610367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).