C21H24N4O2S — CID 87610510
N-benzyl-4-[(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline acetate (PubChem CID 87610510) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is N-benzyl-4-[(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline acetate.
| Compound Name | N-benzyl-4-[(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline acetate |
|---|---|
| PubChem CID | 87610510 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-benzyl-4-[(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline acetate |
| SMILES | CC(=O)[O-].Cc1sc(/N=N/c2ccc(NCc3ccccc3)cc2)[n+](C)c1C |
| InChI | InChI=1S/C19H20N4S.C2H4O2/c1-14-15(2)24-19(23(14)3)22-21-18-11-9-17(10-12-18)20-13-16-7-5-4-6-8-16;1-2(3)4/h4-12H,13H2,1-3H3;1H3,(H,3,4) |
| InChIKey | DHONSLOKICLYRY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|