C6H5N3OS — CID 87610709
6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazole-5-carbaldehyde (PubChem CID 87610709) has the molecular formula C6H5N3OS and a molecular weight of 167.19 g/mol. Its IUPAC name is 6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazole-5-carbaldehyde.
| Compound Name | 6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazole-5-carbaldehyde |
|---|---|
| PubChem CID | 87610709 |
| Molecular Formula | C6H5N3OS |
| Molecular Weight | 167.19 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | 6-methyl-[1,3]thiazolo[3,2-b][1,2,4]triazole-5-carbaldehyde |
| SMILES | Cc1c(C=O)sc2ncnn12 |
| InChI | InChI=1S/C6H5N3OS/c1-4-5(2-10)11-6-7-3-8-9(4)6/h2-3H,1H3 |
| InChIKey | MFJUPLCSTWTURK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|