C28H32F7N3O2 — CID 87610808
(2S)-N-[3-[3,5-bis(trifluoromethyl)phenyl]propyl]-2-(4-fluoro-2-methylphenyl)-4-morpholin-4-ylpiperidine-1-carboxamide (PubChem CID 87610808) has the molecular formula C28H32F7N3O2 and a molecular weight of 575.57 g/mol. Its IUPAC name is (2S)-N-[3-[3,5-bis(trifluoromethyl)phenyl]propyl]-2-(4-fluoro-2-methylphenyl)-4-morpholin-4-ylpiperidine-1-carboxamide.
| Compound Name | (2S)-N-[3-[3,5-bis(trifluoromethyl)phenyl]propyl]-2-(4-fluoro-2-methylphenyl)-4-morpholin-4-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 87610808 |
| Molecular Formula | C28H32F7N3O2 |
| Molecular Weight | 575.57 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | (2S)-N-[3-[3,5-bis(trifluoromethyl)phenyl]propyl]-2-(4-fluoro-2-methylphenyl)-4-morpholin-4-ylpiperidine-1-carboxamide |
| SMILES | Cc1cc(F)ccc1[C@@H]1CC(N2CCOCC2)CCN1C(=O)NCCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H32F7N3O2/c1-18-13-22(29)4-5-24(18)25-17-23(37-9-11-40-12-10-37)6-8-38(25)26(39)36-7-2-3-19-14-20(27(30,31)32)16-21(15-19)28(33,34)35/h4-5,13-16,23,25H,2-3,6-12,17H2,1H3,(H,36,39)/t23?,25-/m0/s1 |
| InChIKey | PHTUVYFWSCPZFI-YNMFNDETSA-N |
| XLogP | 6.35 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.57 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|