About N-benzyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;methyl sulfate
N-benzyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;methyl sulfate (PubChem CID 87611259) has the molecular formula C18H20N4O4S2
and a molecular weight of 420.52 g/mol. Its IUPAC name is N-benzyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;methyl sulfate.
Molecular Properties
| Compound Name | N-benzyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;methyl sulfate |
| PubChem CID | 87611259 |
| Molecular Formula | C18H20N4O4S2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | N-benzyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].C[n+]1ccsc1/N=N/c1ccc(NCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H16N4S.CH4O4S/c1-21-11-12-22-17(21)20-19-16-9-7-15(8-10-16)18-13-14-5-3-2-4-6-14;1-5-6(2,3)4/h2-12H,13H2,1H3;1H3,(H,2,3,4) |
| InChIKey | LLKYRXUFVPHCBV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;methyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;methyl sulfate?
The IUPAC name of N-benzyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;methyl sulfate (CID 87611259) is N-benzyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;methyl sulfate.
What is the SMILES notation for N-benzyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;methyl sulfate?
The canonical SMILES for N-benzyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;methyl sulfate is COS(=O)(=O)[O-].C[n+]1ccsc1/N=N/c1ccc(NCc2ccccc2)cc1.
What is the InChIKey of N-benzyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;methyl sulfate?
The InChIKey is LLKYRXUFVPHCBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4S.CH4O4S/c1-21-11-12-22-17(21)20-19-16-9-7-15(8-10-16)18-13-14-5-3-2-4-6-14;1-5-6(2,3)4/h2-12H,13H2,1H3;1H3,(H,2,3,4).
What are the key properties of N-benzyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;methyl sulfate?
N-benzyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;methyl sulfate has a molecular weight of 420.52 g/mol, XLogP of 3.69, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4-[(3-methyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline;methyl sulfate is sourced from PubChem (CID 87611259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).