About 1,2-dihydroimidazol-2-ide;2-methylcyclopenta-1,3-diene;ruthenium(2+)
1,2-dihydroimidazol-2-ide;2-methylcyclopenta-1,3-diene;ruthenium(2+) (PubChem CID 87611518) has the molecular formula C9H10N2Ru
and a molecular weight of 247.26 g/mol. Its IUPAC name is 1,2-dihydroimidazol-2-ide;2-methylcyclopenta-1,3-diene;ruthenium(2+).
Molecular Properties
| Compound Name | 1,2-dihydroimidazol-2-ide;2-methylcyclopenta-1,3-diene;ruthenium(2+) |
| PubChem CID | 87611518 |
| Molecular Formula | C9H10N2Ru |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.99 |
| IUPAC Name | 1,2-dihydroimidazol-2-ide;2-methylcyclopenta-1,3-diene;ruthenium(2+) |
| SMILES | CC1=[C-]CC=C1.[Ru+2].[c-]1ncc[nH]1 |
| InChI | InChI=1S/C6H7.C3H3N2.Ru/c1-6-4-2-3-5-6;1-2-5-3-4-1;/h2,4H,3H2,1H3;1-2H,(H,4,5);/q2*-1;+2 |
| InChIKey | ZSBXIMTVMOIRFU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dihydroimidazol-2-ide;2-methylcyclopenta-1,3-diene;ruthenium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydroimidazol-2-ide;2-methylcyclopenta-1,3-diene;ruthenium(2+)?
The IUPAC name of 1,2-dihydroimidazol-2-ide;2-methylcyclopenta-1,3-diene;ruthenium(2+) (CID 87611518) is 1,2-dihydroimidazol-2-ide;2-methylcyclopenta-1,3-diene;ruthenium(2+).
What is the SMILES notation for 1,2-dihydroimidazol-2-ide;2-methylcyclopenta-1,3-diene;ruthenium(2+)?
The canonical SMILES for 1,2-dihydroimidazol-2-ide;2-methylcyclopenta-1,3-diene;ruthenium(2+) is CC1=[C-]CC=C1.[Ru+2].[c-]1ncc[nH]1.
What is the InChIKey of 1,2-dihydroimidazol-2-ide;2-methylcyclopenta-1,3-diene;ruthenium(2+)?
The InChIKey is ZSBXIMTVMOIRFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7.C3H3N2.Ru/c1-6-4-2-3-5-6;1-2-5-3-4-1;/h2,4H,3H2,1H3;1-2H,(H,4,5);/q2*-1;+2.
What are the key properties of 1,2-dihydroimidazol-2-ide;2-methylcyclopenta-1,3-diene;ruthenium(2+)?
1,2-dihydroimidazol-2-ide;2-methylcyclopenta-1,3-diene;ruthenium(2+) has a molecular weight of 247.26 g/mol, XLogP of 1.90, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydroimidazol-2-ide;2-methylcyclopenta-1,3-diene;ruthenium(2+) is sourced from PubChem (CID 87611518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).