C20H22FNO3S — CID 87611646
[1-[4-(4-fluorophenyl)-1,2,3,6-tetrahydropyridin-3-yl]-2-phenylethyl] methanesulfonate (PubChem CID 87611646) has the molecular formula C20H22FNO3S and a molecular weight of 375.47 g/mol. Its IUPAC name is [1-[4-(4-fluorophenyl)-1,2,3,6-tetrahydropyridin-3-yl]-2-phenylethyl] methanesulfonate.
| Compound Name | [1-[4-(4-fluorophenyl)-1,2,3,6-tetrahydropyridin-3-yl]-2-phenylethyl] methanesulfonate |
|---|---|
| PubChem CID | 87611646 |
| Molecular Formula | C20H22FNO3S |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [1-[4-(4-fluorophenyl)-1,2,3,6-tetrahydropyridin-3-yl]-2-phenylethyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC(Cc1ccccc1)C1CNCC=C1c1ccc(F)cc1 |
| InChI | InChI=1S/C20H22FNO3S/c1-26(23,24)25-20(13-15-5-3-2-4-6-15)19-14-22-12-11-18(19)16-7-9-17(21)10-8-16/h2-11,19-20,22H,12-14H2,1H3 |
| InChIKey | NBVYZEZWBNOVOP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|