piperidine-1-carbonyl fluoride

C6H10FNO — CID 87612054

IUPACpiperidine-1-carbonyl fluoride
SMILESO=C(F)N1CCCCC1
InChIInChI=1S/C6H10FNO/c7-6(9)8-4-2-1-3-5-8/h1-5H2
InChIKeyLLFVALSSFLXAQB-UHFFFAOYSA-N
MW131.15 g/mol
LogP1.56
Rot. Bonds

About piperidine-1-carbonyl fluoride

piperidine-1-carbonyl fluoride (PubChem CID 87612054) has the molecular formula C6H10FNO and a molecular weight of 131.15 g/mol. Its IUPAC name is piperidine-1-carbonyl fluoride.

Molecular Properties

Compound Namepiperidine-1-carbonyl fluoride
PubChem CID87612054
Molecular FormulaC6H10FNO
Molecular Weight131.15 g/mol
Exact Mass131.07
IUPAC Namepiperidine-1-carbonyl fluoride
SMILESO=C(F)N1CCCCC1
InChIInChI=1S/C6H10FNO/c7-6(9)8-4-2-1-3-5-8/h1-5H2
InChIKeyLLFVALSSFLXAQB-UHFFFAOYSA-N
XLogP1.56
TPSA20.31 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500131.15
LogP ≤ 51.56
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze piperidine-1-carbonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

1-Piperidinecarboxaldehyde
CID 17429
Piperidine, 1-fluoroacetyl-
CID 120208
1-Piperidinecarbonyl chloride
CID 242085
1-Trifluoroacetyl piperidine
CID 5181830
4,4-Difluoropiperidine-1-carbonyl chloride
CID 55263424
3,3-Difluoropiperidine-1-carbonyl chloride
CID 116991545
Lithium piperidin-1-ylmethanone
CID 12464075
Piperidine carboxylate
CID 21874245
Piperidine-1-carbonyl bromide
CID 45081720
4-Fluoropiperidine-1-carboxylic acid
CID 23090127
2-Fluoropiperidine-1-carboxylic acid
CID 23110097
2,2-Difluoro-1-(1-Piperidinyl)Ethanone
CID 45080759

Frequently Asked Questions

What is the IUPAC name of piperidine-1-carbonyl fluoride?
The IUPAC name of piperidine-1-carbonyl fluoride (CID 87612054) is piperidine-1-carbonyl fluoride.
What is the SMILES notation for piperidine-1-carbonyl fluoride?
The canonical SMILES for piperidine-1-carbonyl fluoride is O=C(F)N1CCCCC1.
What is the InChIKey of piperidine-1-carbonyl fluoride?
The InChIKey is LLFVALSSFLXAQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10FNO/c7-6(9)8-4-2-1-3-5-8/h1-5H2.
What are the key properties of piperidine-1-carbonyl fluoride?
piperidine-1-carbonyl fluoride has a molecular weight of 131.15 g/mol, XLogP of 1.56, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine-1-carbonyl fluoride is sourced from PubChem (CID 87612054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).