About acetonitrile;3,3-dichloropropanenitrile
acetonitrile;3,3-dichloropropanenitrile (PubChem CID 87612071) has the molecular formula C5H6Cl2N2
and a molecular weight of 165.02 g/mol. Its IUPAC name is acetonitrile;3,3-dichloropropanenitrile.
Molecular Properties
| Compound Name | acetonitrile;3,3-dichloropropanenitrile |
| PubChem CID | 87612071 |
| Molecular Formula | C5H6Cl2N2 |
| Molecular Weight | 165.02 g/mol |
| Exact Mass | 163.99 |
| IUPAC Name | acetonitrile;3,3-dichloropropanenitrile |
| SMILES | CC#N.N#CCC(Cl)Cl |
| InChI | InChI=1S/C3H3Cl2N.C2H3N/c4-3(5)1-2-6;1-2-3/h3H,1H2;1H3 |
| InChIKey | IAIHQUNWBAIHTB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.02 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;3,3-dichloropropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;3,3-dichloropropanenitrile?
The IUPAC name of acetonitrile;3,3-dichloropropanenitrile (CID 87612071) is acetonitrile;3,3-dichloropropanenitrile.
What is the SMILES notation for acetonitrile;3,3-dichloropropanenitrile?
The canonical SMILES for acetonitrile;3,3-dichloropropanenitrile is CC#N.N#CCC(Cl)Cl.
What is the InChIKey of acetonitrile;3,3-dichloropropanenitrile?
The InChIKey is IAIHQUNWBAIHTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3Cl2N.C2H3N/c4-3(5)1-2-6;1-2-3/h3H,1H2;1H3.
What are the key properties of acetonitrile;3,3-dichloropropanenitrile?
acetonitrile;3,3-dichloropropanenitrile has a molecular weight of 165.02 g/mol, XLogP of 2.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;3,3-dichloropropanenitrile is sourced from PubChem (CID 87612071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).