C14H23N3O4S — CID 87612585
(3-oxo-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-8-yl)sulfanyl hydrogen carbonate (PubChem CID 87612585) has the molecular formula C14H23N3O4S and a molecular weight of 329.42 g/mol. Its IUPAC name is (3-oxo-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-8-yl)sulfanyl hydrogen carbonate.
| Compound Name | (3-oxo-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-8-yl)sulfanyl hydrogen carbonate |
|---|---|
| PubChem CID | 87612585 |
| Molecular Formula | C14H23N3O4S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (3-oxo-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-8-yl)sulfanyl hydrogen carbonate |
| SMILES | C=CCN1C(=O)C(C(C)C)NC12CCN(SOC(=O)O)CC2 |
| InChI | InChI=1S/C14H23N3O4S/c1-4-7-17-12(18)11(10(2)3)15-14(17)5-8-16(9-6-14)22-21-13(19)20/h4,10-11,15H,1,5-9H2,2-3H3,(H,19,20) |
| InChIKey | FSJVBNCYKGCJPO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|