C19H22N2O3 — CID 876127
N-[4-(butanoylamino)phenyl]-3-ethoxybenzamide (PubChem CID 876127) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[4-(butanoylamino)phenyl]-3-ethoxybenzamide.
| Compound Name | N-[4-(butanoylamino)phenyl]-3-ethoxybenzamide |
|---|---|
| PubChem CID | 876127 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N-[4-(butanoylamino)phenyl]-3-ethoxybenzamide |
| SMILES | CCCC(=O)Nc1ccc(NC(=O)c2cccc(OCC)c2)cc1 |
| InChI | InChI=1S/C19H22N2O3/c1-3-6-18(22)20-15-9-11-16(12-10-15)21-19(23)14-7-5-8-17(13-14)24-4-2/h5,7-13H,3-4,6H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | HLELZPABNOSUFU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |