About 3,6-dichloropyridazine;imidazo[1,2-b]pyridazine
3,6-dichloropyridazine;imidazo[1,2-b]pyridazine (PubChem CID 87612702) has the molecular formula C10H7Cl2N5
and a molecular weight of 268.11 g/mol. Its IUPAC name is 3,6-dichloropyridazine;imidazo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 3,6-dichloropyridazine;imidazo[1,2-b]pyridazine |
| PubChem CID | 87612702 |
| Molecular Formula | C10H7Cl2N5 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | 3,6-dichloropyridazine;imidazo[1,2-b]pyridazine |
| SMILES | Clc1ccc(Cl)nn1.c1cnn2ccnc2c1 |
| InChI | InChI=1S/C6H5N3.C4H2Cl2N2/c1-2-6-7-4-5-9(6)8-3-1;5-3-1-2-4(6)8-7-3/h1-5H;1-2H |
| InChIKey | XWVNSZVDFWWGME-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,6-dichloropyridazine;imidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dichloropyridazine;imidazo[1,2-b]pyridazine?
The IUPAC name of 3,6-dichloropyridazine;imidazo[1,2-b]pyridazine (CID 87612702) is 3,6-dichloropyridazine;imidazo[1,2-b]pyridazine.
What is the SMILES notation for 3,6-dichloropyridazine;imidazo[1,2-b]pyridazine?
The canonical SMILES for 3,6-dichloropyridazine;imidazo[1,2-b]pyridazine is Clc1ccc(Cl)nn1.c1cnn2ccnc2c1.
What is the InChIKey of 3,6-dichloropyridazine;imidazo[1,2-b]pyridazine?
The InChIKey is XWVNSZVDFWWGME-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3.C4H2Cl2N2/c1-2-6-7-4-5-9(6)8-3-1;5-3-1-2-4(6)8-7-3/h1-5H;1-2H.
What are the key properties of 3,6-dichloropyridazine;imidazo[1,2-b]pyridazine?
3,6-dichloropyridazine;imidazo[1,2-b]pyridazine has a molecular weight of 268.11 g/mol, XLogP of 2.51, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dichloropyridazine;imidazo[1,2-b]pyridazine is sourced from PubChem (CID 87612702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).