C17H30N4O3S — CID 87612710
(3-oxo-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-8-yl)sulfanyl N-propan-2-ylcarbamate (PubChem CID 87612710) has the molecular formula C17H30N4O3S and a molecular weight of 370.52 g/mol. Its IUPAC name is (3-oxo-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-8-yl)sulfanyl N-propan-2-ylcarbamate.
| Compound Name | (3-oxo-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-8-yl)sulfanyl N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 87612710 |
| Molecular Formula | C17H30N4O3S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (3-oxo-2-propan-2-yl-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-8-yl)sulfanyl N-propan-2-ylcarbamate |
| SMILES | C=CCN1C(=O)C(C(C)C)NC12CCN(SOC(=O)NC(C)C)CC2 |
| InChI | InChI=1S/C17H30N4O3S/c1-6-9-21-15(22)14(12(2)3)19-17(21)7-10-20(11-8-17)25-24-16(23)18-13(4)5/h6,12-14,19H,1,7-11H2,2-5H3,(H,18,23) |
| InChIKey | LKMLRXCTIYOOFQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|