About 2-[2-(difluoromethoxy)-5-(furan-2-yl)phenyl]-3,4,5-trimethoxybenzaldehyde
2-[2-(difluoromethoxy)-5-(furan-2-yl)phenyl]-3,4,5-trimethoxybenzaldehyde (PubChem CID 87612809) has the molecular formula C21H18F2O6
and a molecular weight of 404.37 g/mol. Its IUPAC name is 2-[2-(difluoromethoxy)-5-(furan-2-yl)phenyl]-3,4,5-trimethoxybenzaldehyde.
Molecular Properties
| Compound Name | 2-[2-(difluoromethoxy)-5-(furan-2-yl)phenyl]-3,4,5-trimethoxybenzaldehyde |
| PubChem CID | 87612809 |
| Molecular Formula | C21H18F2O6 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2-[2-(difluoromethoxy)-5-(furan-2-yl)phenyl]-3,4,5-trimethoxybenzaldehyde |
| SMILES | COc1cc(C=O)c(-c2cc(-c3ccco3)ccc2OC(F)F)c(OC)c1OC |
| InChI | InChI=1S/C21H18F2O6/c1-25-17-10-13(11-24)18(20(27-3)19(17)26-2)14-9-12(15-5-4-8-28-15)6-7-16(14)29-21(22)23/h4-11,21H,1-3H3 |
| InChIKey | YEZSGLBAXWLTCI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(difluoromethoxy)-5-(furan-2-yl)phenyl]-3,4,5-trimethoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(difluoromethoxy)-5-(furan-2-yl)phenyl]-3,4,5-trimethoxybenzaldehyde?
The IUPAC name of 2-[2-(difluoromethoxy)-5-(furan-2-yl)phenyl]-3,4,5-trimethoxybenzaldehyde (CID 87612809) is 2-[2-(difluoromethoxy)-5-(furan-2-yl)phenyl]-3,4,5-trimethoxybenzaldehyde.
What is the SMILES notation for 2-[2-(difluoromethoxy)-5-(furan-2-yl)phenyl]-3,4,5-trimethoxybenzaldehyde?
The canonical SMILES for 2-[2-(difluoromethoxy)-5-(furan-2-yl)phenyl]-3,4,5-trimethoxybenzaldehyde is COc1cc(C=O)c(-c2cc(-c3ccco3)ccc2OC(F)F)c(OC)c1OC.
What is the InChIKey of 2-[2-(difluoromethoxy)-5-(furan-2-yl)phenyl]-3,4,5-trimethoxybenzaldehyde?
The InChIKey is YEZSGLBAXWLTCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F2O6/c1-25-17-10-13(11-24)18(20(27-3)19(17)26-2)14-9-12(15-5-4-8-28-15)6-7-16(14)29-21(22)23/h4-11,21H,1-3H3.
What are the key properties of 2-[2-(difluoromethoxy)-5-(furan-2-yl)phenyl]-3,4,5-trimethoxybenzaldehyde?
2-[2-(difluoromethoxy)-5-(furan-2-yl)phenyl]-3,4,5-trimethoxybenzaldehyde has a molecular weight of 404.37 g/mol, XLogP of 5.05, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(difluoromethoxy)-5-(furan-2-yl)phenyl]-3,4,5-trimethoxybenzaldehyde is sourced from PubChem (CID 87612809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).