C20H19N4O4+ — CID 87613193
3-(4-nitronaphthalen-1-yl)-9-prop-2-enyl-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decane-2,4-dione (PubChem CID 87613193) has the molecular formula C20H19N4O4+ and a molecular weight of 379.40 g/mol. Its IUPAC name is 3-(4-nitronaphthalen-1-yl)-9-prop-2-enyl-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decane-2,4-dione.
| Compound Name | 3-(4-nitronaphthalen-1-yl)-9-prop-2-enyl-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decane-2,4-dione |
|---|---|
| PubChem CID | 87613193 |
| Molecular Formula | C20H19N4O4+ |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 3-(4-nitronaphthalen-1-yl)-9-prop-2-enyl-3,7-diaza-1-azoniatricyclo[5.2.1.01,5]decane-2,4-dione |
| SMILES | C=CCC1CN2CC3C(=O)N(c4ccc([N+](=O)[O-])c5ccccc45)C(=O)[N+]13C2 |
| InChI | InChI=1S/C20H19N4O4/c1-2-5-13-10-21-11-18-19(25)22(20(26)24(13,18)12-21)16-8-9-17(23(27)28)15-7-4-3-6-14(15)16/h2-4,6-9,13,18H,1,5,10-12H2/q+1 |
| InChIKey | YXYPZFDKOBXDAA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|