C21H19N6O6S+ — CID 87613484
9-(1-methylimidazol-4-yl)sulfonyl-3-(4-nitronaphthalen-1-yl)-3,7-diaza-1-azoniatricyclo[6.1.1.01,5]decane-2,4-dione (PubChem CID 87613484) has the molecular formula C21H19N6O6S+ and a molecular weight of 483.49 g/mol. Its IUPAC name is 9-(1-methylimidazol-4-yl)sulfonyl-3-(4-nitronaphthalen-1-yl)-3,7-diaza-1-azoniatricyclo[6.1.1.01,5]decane-2,4-dione.
| Compound Name | 9-(1-methylimidazol-4-yl)sulfonyl-3-(4-nitronaphthalen-1-yl)-3,7-diaza-1-azoniatricyclo[6.1.1.01,5]decane-2,4-dione |
|---|---|
| PubChem CID | 87613484 |
| Molecular Formula | C21H19N6O6S+ |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 9-(1-methylimidazol-4-yl)sulfonyl-3-(4-nitronaphthalen-1-yl)-3,7-diaza-1-azoniatricyclo[6.1.1.01,5]decane-2,4-dione |
| SMILES | Cn1cnc(S(=O)(=O)C2C3C[N+]24C(=O)N(c2ccc([N+](=O)[O-])c5ccccc25)C(=O)C4CN3)c1 |
| InChI | InChI=1S/C21H19N6O6S/c1-24-9-18(23-11-24)34(32,33)20-14-10-27(20)17(8-22-14)19(28)25(21(27)29)15-6-7-16(26(30)31)13-5-3-2-4-12(13)15/h2-7,9,11,14,17,20,22H,8,10H2,1H3/q+1 |
| InChIKey | FKGHEMGBZHEKAZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 144.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|