About 8-benzyl-3-(2-methylpropyl)-2-propan-2-ylpyrazolo[1,5-a]pyridin-8-ium
8-benzyl-3-(2-methylpropyl)-2-propan-2-ylpyrazolo[1,5-a]pyridin-8-ium (PubChem CID 87613557) has the molecular formula C21H27N2+
and a molecular weight of 307.46 g/mol. Its IUPAC name is 8-benzyl-3-(2-methylpropyl)-2-propan-2-ylpyrazolo[1,5-a]pyridin-8-ium.
Molecular Properties
| Compound Name | 8-benzyl-3-(2-methylpropyl)-2-propan-2-ylpyrazolo[1,5-a]pyridin-8-ium |
| PubChem CID | 87613557 |
| Molecular Formula | C21H27N2+ |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.22 |
| IUPAC Name | 8-benzyl-3-(2-methylpropyl)-2-propan-2-ylpyrazolo[1,5-a]pyridin-8-ium |
| SMILES | CC(C)CC1=C2C=CC=C[N+]2(Cc2ccccc2)N=C1C(C)C |
| InChI | InChI=1S/C21H27N2/c1-16(2)14-19-20-12-8-9-13-23(20,22-21(19)17(3)4)15-18-10-6-5-7-11-18/h5-13,16-17H,14-15H2,1-4H3/q+1 |
| InChIKey | YUOQNJWPZMNNFF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 8-benzyl-3-(2-methylpropyl)-2-propan-2-ylpyrazolo[1,5-a]pyridin-8-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-benzyl-3-(2-methylpropyl)-2-propan-2-ylpyrazolo[1,5-a]pyridin-8-ium?
The IUPAC name of 8-benzyl-3-(2-methylpropyl)-2-propan-2-ylpyrazolo[1,5-a]pyridin-8-ium (CID 87613557) is 8-benzyl-3-(2-methylpropyl)-2-propan-2-ylpyrazolo[1,5-a]pyridin-8-ium.
What is the SMILES notation for 8-benzyl-3-(2-methylpropyl)-2-propan-2-ylpyrazolo[1,5-a]pyridin-8-ium?
The canonical SMILES for 8-benzyl-3-(2-methylpropyl)-2-propan-2-ylpyrazolo[1,5-a]pyridin-8-ium is CC(C)CC1=C2C=CC=C[N+]2(Cc2ccccc2)N=C1C(C)C.
What is the InChIKey of 8-benzyl-3-(2-methylpropyl)-2-propan-2-ylpyrazolo[1,5-a]pyridin-8-ium?
The InChIKey is YUOQNJWPZMNNFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N2/c1-16(2)14-19-20-12-8-9-13-23(20,22-21(19)17(3)4)15-18-10-6-5-7-11-18/h5-13,16-17H,14-15H2,1-4H3/q+1.
What are the key properties of 8-benzyl-3-(2-methylpropyl)-2-propan-2-ylpyrazolo[1,5-a]pyridin-8-ium?
8-benzyl-3-(2-methylpropyl)-2-propan-2-ylpyrazolo[1,5-a]pyridin-8-ium has a molecular weight of 307.46 g/mol, XLogP of 5.41, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-benzyl-3-(2-methylpropyl)-2-propan-2-ylpyrazolo[1,5-a]pyridin-8-ium is sourced from PubChem (CID 87613557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).