butyl(chloro)phosphinous acid

C4H10ClOP — CID 87614163

IUPACbutyl(chloro)phosphinous acid
SMILESCCCCP(O)Cl
InChIInChI=1S/C4H10ClOP/c1-2-3-4-7(5)6/h6H,2-4H2,1H3
InChIKeyLSZFJSRKIPFLJR-UHFFFAOYSA-N
MW140.55 g/mol
LogP2.33
Rot. Bonds3

About butyl(chloro)phosphinous acid

butyl(chloro)phosphinous acid (PubChem CID 87614163) has the molecular formula C4H10ClOP and a molecular weight of 140.55 g/mol. Its IUPAC name is butyl(chloro)phosphinous acid.

Molecular Properties

Compound Namebutyl(chloro)phosphinous acid
PubChem CID87614163
Molecular FormulaC4H10ClOP
Molecular Weight140.55 g/mol
Exact Mass140.02
IUPAC Namebutyl(chloro)phosphinous acid
SMILESCCCCP(O)Cl
InChIInChI=1S/C4H10ClOP/c1-2-3-4-7(5)6/h6H,2-4H2,1H3
InChIKeyLSZFJSRKIPFLJR-UHFFFAOYSA-N
XLogP2.33
TPSA20.23 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500140.55
LogP ≤ 52.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze butyl(chloro)phosphinous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butyl(chloro)phosphinous acid?
The IUPAC name of butyl(chloro)phosphinous acid (CID 87614163) is butyl(chloro)phosphinous acid.
What is the SMILES notation for butyl(chloro)phosphinous acid?
The canonical SMILES for butyl(chloro)phosphinous acid is CCCCP(O)Cl.
What is the InChIKey of butyl(chloro)phosphinous acid?
The InChIKey is LSZFJSRKIPFLJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10ClOP/c1-2-3-4-7(5)6/h6H,2-4H2,1H3.
What are the key properties of butyl(chloro)phosphinous acid?
butyl(chloro)phosphinous acid has a molecular weight of 140.55 g/mol, XLogP of 2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(chloro)phosphinous acid is sourced from PubChem (CID 87614163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).