C29H34F2O6S2 — CID 87614172
2-(1-adamantylmethoxy)-1,1-difluoro-2-oxoethanesulfonate;2-naphthalen-2-yl-2-(thiolan-1-ium-1-yl)acetaldehyde (PubChem CID 87614172) has the molecular formula C29H34F2O6S2 and a molecular weight of 580.72 g/mol. Its IUPAC name is 2-(1-adamantylmethoxy)-1,1-difluoro-2-oxoethanesulfonate;2-naphthalen-2-yl-2-(thiolan-1-ium-1-yl)acetaldehyde.
| Compound Name | 2-(1-adamantylmethoxy)-1,1-difluoro-2-oxoethanesulfonate;2-naphthalen-2-yl-2-(thiolan-1-ium-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 87614172 |
| Molecular Formula | C29H34F2O6S2 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | 2-(1-adamantylmethoxy)-1,1-difluoro-2-oxoethanesulfonate;2-naphthalen-2-yl-2-(thiolan-1-ium-1-yl)acetaldehyde |
| SMILES | O=C(OCC12CC3CC(CC(C3)C1)C2)C(F)(F)S(=O)(=O)[O-].O=CC(c1ccc2ccccc2c1)[S+]1CCCC1 |
| InChI | InChI=1S/C16H17OS.C13H18F2O5S/c17-12-16(18-9-3-4-10-18)15-8-7-13-5-1-2-6-14(13)11-15;14-13(15,21(17,18)19)11(16)20-7-12-4-8-1-9(5-12)3-10(2-8)6-12/h1-2,5-8,11-12,16H,3-4,9-10H2;8-10H,1-7H2,(H,17,18,19)/q+1;/p-1 |
| InChIKey | JJDHJMJKUWKPCO-UHFFFAOYSA-M |
| XLogP | 5.38 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|